C56H56N4O6 — CID 158737659
6-[2-phenyl-3-(3-phenylprop-2-enyl)benzimidazol-5-yl]oxyhexanoic acid (PubChem CID 158737659) has the molecular formula C56H56N4O6 and a molecular weight of 881.09 g/mol. Its IUPAC name is 6-[2-phenyl-3-(3-phenylprop-2-enyl)benzimidazol-5-yl]oxyhexanoic acid.
| Compound Name | 6-[2-phenyl-3-(3-phenylprop-2-enyl)benzimidazol-5-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 158737659 |
| Molecular Formula | C56H56N4O6 |
| Molecular Weight | 881.09 g/mol |
| Exact Mass | 880.42 |
| IUPAC Name | 6-[2-phenyl-3-(3-phenylprop-2-enyl)benzimidazol-5-yl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccc2nc(-c3ccccc3)n(CC=Cc3ccccc3)c2c1.O=C(O)CCCCCOc1ccc2nc(-c3ccccc3)n(CC=Cc3ccccc3)c2c1 |
| InChI | InChI=1S/2C28H28N2O3/c2*31-27(32)16-8-3-9-20-33-24-17-18-25-26(21-24)30(19-10-13-22-11-4-1-5-12-22)28(29-25)23-14-6-2-7-15-23/h2*1-2,4-7,10-15,17-18,21H,3,8-9,16,19-20H2,(H,31,32) |
| InChIKey | ILWPUWWKZFINKC-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.09 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|