C28H26N2O4S — CID 134066845
diethyl 2-(1,4,5-triphenylimidazol-2-yl)sulfanylpropanedioate (PubChem CID 134066845) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is diethyl 2-(1,4,5-triphenylimidazol-2-yl)sulfanylpropanedioate.
| Compound Name | diethyl 2-(1,4,5-triphenylimidazol-2-yl)sulfanylpropanedioate |
|---|---|
| PubChem CID | 134066845 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | diethyl 2-(1,4,5-triphenylimidazol-2-yl)sulfanylpropanedioate |
| SMILES | CCOC(=O)C(Sc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C28H26N2O4S/c1-3-33-26(31)25(27(32)34-4-2)35-28-29-23(20-14-8-5-9-15-20)24(21-16-10-6-11-17-21)30(28)22-18-12-7-13-19-22/h5-19,25H,3-4H2,1-2H3 |
| InChIKey | LTMHFVAFKXJBLA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|