C32H36N2O3S — CID 54339448
2-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]sulfanyldecanoic acid (PubChem CID 54339448) has the molecular formula C32H36N2O3S and a molecular weight of 528.72 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]sulfanyldecanoic acid.
| Compound Name | 2-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]sulfanyldecanoic acid |
|---|---|
| PubChem CID | 54339448 |
| Molecular Formula | C32H36N2O3S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]sulfanyldecanoic acid |
| SMILES | CCCCCCCCC(Sc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C32H36N2O3S/c1-3-4-5-6-7-14-19-28(31(35)36)38-32-33-29(24-15-10-8-11-16-24)30(25-17-12-9-13-18-25)34(32)26-20-22-27(37-2)23-21-26/h8-13,15-18,20-23,28H,3-7,14,19H2,1-2H3,(H,35,36) |
| InChIKey | TXWWCPDFLWPRII-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|