C24H29N3O3S — CID 45060279
2-[[5-(4-butoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]hexanoic acid (PubChem CID 45060279) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]hexanoic acid.
| Compound Name | 2-[[5-(4-butoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 45060279 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]hexanoic acid |
| SMILES | CCCCOc1ccc(-c2nnc(SC(CCCC)C(=O)O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-3-5-12-21(23(28)29)31-24-26-25-22(27(24)19-10-8-7-9-11-19)18-13-15-20(16-14-18)30-17-6-4-2/h7-11,13-16,21H,3-6,12,17H2,1-2H3,(H,28,29) |
| InChIKey | CQAIDAPEFSBKNH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|