C22H21N3OS — CID 3165887
3-(4-butoxyphenyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 3165887) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 3-(4-butoxyphenyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 3165887 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-(4-butoxyphenyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | CCCCOc1ccc(-c2nnc(-c3cccs3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-2-3-15-26-19-13-11-17(12-14-19)21-23-24-22(20-10-7-16-27-20)25(21)18-8-5-4-6-9-18/h4-14,16H,2-3,15H2,1H3 |
| InChIKey | IKURKALKJMMTBH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|