C21H21N3O4S — CID 134066812
diethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanedioate (PubChem CID 134066812) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is diethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanedioate.
| Compound Name | diethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanedioate |
|---|---|
| PubChem CID | 134066812 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | diethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanedioate |
| SMILES | CCOC(=O)C(Sc1nnc(-c2ccccc2)n1-c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C21H21N3O4S/c1-3-27-19(25)17(20(26)28-4-2)29-21-23-22-18(15-11-7-5-8-12-15)24(21)16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3 |
| InChIKey | XETAMBYCVFKDAW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|