C33H31N3OS — CID 3378636
2-phenyl-N-[2-(1,4,5-triphenylimidazol-2-yl)sulfanylethyl]butanamide (PubChem CID 3378636) has the molecular formula C33H31N3OS and a molecular weight of 517.70 g/mol. Its IUPAC name is 2-phenyl-N-[2-(1,4,5-triphenylimidazol-2-yl)sulfanylethyl]butanamide.
| Compound Name | 2-phenyl-N-[2-(1,4,5-triphenylimidazol-2-yl)sulfanylethyl]butanamide |
|---|---|
| PubChem CID | 3378636 |
| Molecular Formula | C33H31N3OS |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-phenyl-N-[2-(1,4,5-triphenylimidazol-2-yl)sulfanylethyl]butanamide |
| SMILES | CCC(C(=O)NCCSc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31N3OS/c1-2-29(25-15-7-3-8-16-25)32(37)34-23-24-38-33-35-30(26-17-9-4-10-18-26)31(27-19-11-5-12-20-27)36(33)28-21-13-6-14-22-28/h3-22,29H,2,23-24H2,1H3,(H,34,37) |
| InChIKey | NPKVYYCYMRDPFX-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|