C28H29N3OS2 — CID 4255231
N-[2-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanylethyl]-2-phenylsulfanylacetamide (PubChem CID 4255231) has the molecular formula C28H29N3OS2 and a molecular weight of 487.69 g/mol. Its IUPAC name is N-[2-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanylethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanylethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 4255231 |
| Molecular Formula | C28H29N3OS2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[2-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanylethyl]-2-phenylsulfanylacetamide |
| SMILES | CC(C)n1c(SCCNC(=O)CSc2ccccc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H29N3OS2/c1-21(2)31-27(23-14-8-4-9-15-23)26(22-12-6-3-7-13-22)30-28(31)33-19-18-29-25(32)20-34-24-16-10-5-11-17-24/h3-17,21H,18-20H2,1-2H3,(H,29,32) |
| InChIKey | SRMZLAXSAGADOZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|