C14H18N4OS2 — CID 7627027
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 7627027) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 7627027 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | Cc1nnc(SCC(=O)NCCSc2ccccc2)n1C |
| InChI | InChI=1S/C14H18N4OS2/c1-11-16-17-14(18(11)2)21-10-13(19)15-8-9-20-12-6-4-3-5-7-12/h3-7H,8-10H2,1-2H3,(H,15,19) |
| InChIKey | HMHQORFOLGKHGZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|