C13H14F3N5OS2 — CID 7605214
2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 7605214) has the molecular formula C13H14F3N5OS2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 7605214 |
| Molecular Formula | C13H14F3N5OS2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | Nn1c(SCC(=O)NCCSc2ccccc2)nnc1C(F)(F)F |
| InChI | InChI=1S/C13H14F3N5OS2/c14-13(15,16)11-19-20-12(21(11)17)24-8-10(22)18-6-7-23-9-4-2-1-3-5-9/h1-5H,6-8,17H2,(H,18,22) |
| InChIKey | BJKYTBWIZDVHGS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|