C17H25N5OS — CID 35975955
2-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide (PubChem CID 35975955) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 2-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 35975955 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide |
| SMILES | CC(C)(C)c1nnc(SCC(=O)NCCCc2ccccc2)n1N |
| InChI | InChI=1S/C17H25N5OS/c1-17(2,3)15-20-21-16(22(15)18)24-12-14(23)19-11-7-10-13-8-5-4-6-9-13/h4-6,8-9H,7,10-12,18H2,1-3H3,(H,19,23) |
| InChIKey | UJVSCXCIPDQQKJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|