C29H38N4OS — CID 4677337
2-[[5-(4-tert-butylphenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide (PubChem CID 4677337) has the molecular formula C29H38N4OS and a molecular weight of 490.72 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 4677337 |
| Molecular Formula | C29H38N4OS |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide |
| SMILES | CC(C)(C)c1ccc(-c2nnc(SCC(=O)NCCCc3ccccc3)n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H38N4OS/c1-29(2,3)24-18-16-23(17-19-24)27-31-32-28(33(27)25-14-8-5-9-15-25)35-21-26(34)30-20-10-13-22-11-6-4-7-12-22/h4,6-7,11-12,16-19,25H,5,8-10,13-15,20-21H2,1-3H3,(H,30,34) |
| InChIKey | ZJXMRJAPJWNPPG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|