C27H34N4O3S — CID 29155486
2-[[4-cyclohexyl-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide (PubChem CID 29155486) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-[[4-cyclohexyl-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[[4-cyclohexyl-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 29155486 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-[[4-cyclohexyl-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)NCCCc3ccccc3)n2C2CCCCC2)cc1OC |
| InChI | InChI=1S/C27H34N4O3S/c1-33-23-16-15-21(18-24(23)34-2)26-29-30-27(31(26)22-13-7-4-8-14-22)35-19-25(32)28-17-9-12-20-10-5-3-6-11-20/h3,5-6,10-11,15-16,18,22H,4,7-9,12-14,17,19H2,1-2H3,(H,28,32) |
| InChIKey | DYQDVZPAOXDPLR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|