C19H20BrN5OS2 — CID 33327168
2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 33327168) has the molecular formula C19H20BrN5OS2 and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 33327168 |
| Molecular Formula | C19H20BrN5OS2 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CSc2nnc(-c3ccccc3Br)n2N)cc1 |
| InChI | InChI=1S/C19H20BrN5OS2/c1-13-6-8-14(9-7-13)27-11-10-22-17(26)12-28-19-24-23-18(25(19)21)15-4-2-3-5-16(15)20/h2-9H,10-12,21H2,1H3,(H,22,26) |
| InChIKey | ZNXJHWJGLMQTGY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|