C16H21N5OS2 — CID 18227488
2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 18227488) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 18227488 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CSc2nnc(C3CC3)n2N)cc1 |
| InChI | InChI=1S/C16H21N5OS2/c1-11-2-6-13(7-3-11)23-9-8-18-14(22)10-24-16-20-19-15(21(16)17)12-4-5-12/h2-3,6-7,12H,4-5,8-10,17H2,1H3,(H,18,22) |
| InChIKey | AAYWIABAXZQGGJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|