C46H35NSi — CID 140869466
triphenyl-(1,2,4,5-tetraphenylpyrrol-3-yl)silane (PubChem CID 140869466) has the molecular formula C46H35NSi and a molecular weight of 629.88 g/mol. Its IUPAC name is triphenyl-(1,2,4,5-tetraphenylpyrrol-3-yl)silane.
| Compound Name | triphenyl-(1,2,4,5-tetraphenylpyrrol-3-yl)silane |
|---|---|
| PubChem CID | 140869466 |
| Molecular Formula | C46H35NSi |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | triphenyl-(1,2,4,5-tetraphenylpyrrol-3-yl)silane |
| SMILES | c1ccc(-c2c([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c(-c3ccccc3)n(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H35NSi/c1-8-22-36(23-9-1)43-44(37-24-10-2-11-25-37)47(39-28-14-4-15-29-39)45(38-26-12-3-13-27-38)46(43)48(40-30-16-5-17-31-40,41-32-18-6-19-33-41)42-34-20-7-21-35-42/h1-35H |
| InChIKey | DBRROWRBCNRNIT-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|