C45H36N2Si — CID 157097721
[4-methyl-1,5-diphenyl-2-(1-phenylpyrrol-3-yl)pyrrol-3-yl]-triphenylsilane (PubChem CID 157097721) has the molecular formula C45H36N2Si and a molecular weight of 632.88 g/mol. Its IUPAC name is [4-methyl-1,5-diphenyl-2-(1-phenylpyrrol-3-yl)pyrrol-3-yl]-triphenylsilane.
| Compound Name | [4-methyl-1,5-diphenyl-2-(1-phenylpyrrol-3-yl)pyrrol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 157097721 |
| Molecular Formula | C45H36N2Si |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | [4-methyl-1,5-diphenyl-2-(1-phenylpyrrol-3-yl)pyrrol-3-yl]-triphenylsilane |
| SMILES | Cc1c([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c(-c2ccn(-c3ccccc3)c2)n(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C45H36N2Si/c1-35-43(36-20-8-2-9-21-36)47(39-24-12-4-13-25-39)44(37-32-33-46(34-37)38-22-10-3-11-23-38)45(35)48(40-26-14-5-15-27-40,41-28-16-6-17-29-41)42-30-18-7-19-31-42/h2-34H,1H3 |
| InChIKey | MPZPNXHORFVDLM-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|