C59H47NSi2 — CID 157413450
[5-methyl-2,4-diphenyl-1-(4-triphenylsilylphenyl)pyrrol-3-yl]-triphenylsilane (PubChem CID 157413450) has the molecular formula C59H47NSi2 and a molecular weight of 826.20 g/mol. Its IUPAC name is [5-methyl-2,4-diphenyl-1-(4-triphenylsilylphenyl)pyrrol-3-yl]-triphenylsilane.
| Compound Name | [5-methyl-2,4-diphenyl-1-(4-triphenylsilylphenyl)pyrrol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 157413450 |
| Molecular Formula | C59H47NSi2 |
| Molecular Weight | 826.20 g/mol |
| Exact Mass | 825.32 |
| IUPAC Name | [5-methyl-2,4-diphenyl-1-(4-triphenylsilylphenyl)pyrrol-3-yl]-triphenylsilane |
| SMILES | Cc1c(-c2ccccc2)c([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c(-c2ccccc2)n1-c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C59H47NSi2/c1-46-57(47-26-10-2-11-27-47)59(62(53-36-20-7-21-37-53,54-38-22-8-23-39-54)55-40-24-9-25-41-55)58(48-28-12-3-13-29-48)60(46)49-42-44-56(45-43-49)61(50-30-14-4-15-31-50,51-32-16-5-17-33-51)52-34-18-6-19-35-52/h2-45H,1H3 |
| InChIKey | BHWCCTUUMBRZPU-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.20 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|