C24H26O4 — CID 139945789
2-[4-(2,5-dihydroxy-3,4,6-trimethylphenyl)phenyl]-3,5,6-trimethylbenzene-1,4-diol (PubChem CID 139945789) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[4-(2,5-dihydroxy-3,4,6-trimethylphenyl)phenyl]-3,5,6-trimethylbenzene-1,4-diol.
| Compound Name | 2-[4-(2,5-dihydroxy-3,4,6-trimethylphenyl)phenyl]-3,5,6-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 139945789 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[4-(2,5-dihydroxy-3,4,6-trimethylphenyl)phenyl]-3,5,6-trimethylbenzene-1,4-diol |
| SMILES | Cc1c(C)c(O)c(-c2ccc(-c3c(C)c(O)c(C)c(C)c3O)cc2)c(C)c1O |
| InChI | InChI=1S/C24H26O4/c1-11-13(3)23(27)19(15(5)21(11)25)17-7-9-18(10-8-17)20-16(6)22(26)12(2)14(4)24(20)28/h7-10,25-28H,1-6H3 |
| InChIKey | GJPAKTHLORPSHT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|