C22H26O4 — CID 173390928
5-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3-methyl-2-pent-1-enylbenzoic acid (PubChem CID 173390928) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 5-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3-methyl-2-pent-1-enylbenzoic acid.
| Compound Name | 5-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3-methyl-2-pent-1-enylbenzoic acid |
|---|---|
| PubChem CID | 173390928 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 5-(2,5-dihydroxy-3,4,6-trimethylphenyl)-3-methyl-2-pent-1-enylbenzoic acid |
| SMILES | CCCC=Cc1c(C)cc(-c2c(C)c(O)c(C)c(C)c2O)cc1C(=O)O |
| InChI | InChI=1S/C22H26O4/c1-6-7-8-9-17-12(2)10-16(11-18(17)22(25)26)19-15(5)20(23)13(3)14(4)21(19)24/h8-11,23-24H,6-7H2,1-5H3,(H,25,26) |
| InChIKey | YGZMDMIEHOOXKR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|