About copper;(2-methoxyphenyl)phosphonic acid
copper;(2-methoxyphenyl)phosphonic acid (PubChem CID 68628754) has the molecular formula C7H9CuO4P
and a molecular weight of 251.66 g/mol. Its IUPAC name is copper;(2-methoxyphenyl)phosphonic acid.
Molecular Properties
| Compound Name | copper;(2-methoxyphenyl)phosphonic acid |
| PubChem CID | 68628754 |
| Molecular Formula | C7H9CuO4P |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 250.95 |
| IUPAC Name | copper;(2-methoxyphenyl)phosphonic acid |
| SMILES | COc1ccccc1P(=O)(O)O.[Cu] |
| InChI | InChI=1S/C7H9O4P.Cu/c1-11-6-4-2-3-5-7(6)12(8,9)10;/h2-5H,1H3,(H2,8,9,10); |
| InChIKey | KIGXPYRARCEUBY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper;(2-methoxyphenyl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(2-methoxyphenyl)phosphonic acid?
The IUPAC name of copper;(2-methoxyphenyl)phosphonic acid (CID 68628754) is copper;(2-methoxyphenyl)phosphonic acid.
What is the SMILES notation for copper;(2-methoxyphenyl)phosphonic acid?
The canonical SMILES for copper;(2-methoxyphenyl)phosphonic acid is COc1ccccc1P(=O)(O)O.[Cu].
What is the InChIKey of copper;(2-methoxyphenyl)phosphonic acid?
The InChIKey is KIGXPYRARCEUBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9O4P.Cu/c1-11-6-4-2-3-5-7(6)12(8,9)10;/h2-5H,1H3,(H2,8,9,10);.
What are the key properties of copper;(2-methoxyphenyl)phosphonic acid?
copper;(2-methoxyphenyl)phosphonic acid has a molecular weight of 251.66 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(2-methoxyphenyl)phosphonic acid is sourced from PubChem (CID 68628754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).