C15H25P — CID 90109528
hexyl-(2,3,4-trimethylphenyl)phosphane (PubChem CID 90109528) has the molecular formula C15H25P and a molecular weight of 236.34 g/mol. Its IUPAC name is hexyl-(2,3,4-trimethylphenyl)phosphane.
| Compound Name | hexyl-(2,3,4-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90109528 |
| Molecular Formula | C15H25P |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | hexyl-(2,3,4-trimethylphenyl)phosphane |
| SMILES | CCCCCCPc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C15H25P/c1-5-6-7-8-11-16-15-10-9-12(2)13(3)14(15)4/h9-10,16H,5-8,11H2,1-4H3 |
| InChIKey | JRIPUCYBVQXPDK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|