C19H33P — CID 69424969
decyl-(2,4,6-trimethylphenyl)phosphane (PubChem CID 69424969) has the molecular formula C19H33P and a molecular weight of 292.45 g/mol. Its IUPAC name is decyl-(2,4,6-trimethylphenyl)phosphane.
| Compound Name | decyl-(2,4,6-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 69424969 |
| Molecular Formula | C19H33P |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | decyl-(2,4,6-trimethylphenyl)phosphane |
| SMILES | CCCCCCCCCCPc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H33P/c1-5-6-7-8-9-10-11-12-13-20-19-17(3)14-16(2)15-18(19)4/h14-15,20H,5-13H2,1-4H3 |
| InChIKey | WZLGHBZJVXYDCV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|