C20H27O5PS — CID 170359256
hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate (PubChem CID 170359256) has the molecular formula C20H27O5PS and a molecular weight of 410.47 g/mol. Its IUPAC name is hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate.
| Compound Name | hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate |
|---|---|
| PubChem CID | 170359256 |
| Molecular Formula | C20H27O5PS |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate |
| SMILES | CCCCCCPOS(=O)(=O)c1ccc(OC)c(-c2ccccc2)c1OC |
| InChI | InChI=1S/C20H27O5PS/c1-4-5-6-10-15-26-25-27(21,22)18-14-13-17(23-2)19(20(18)24-3)16-11-8-7-9-12-16/h7-9,11-14,26H,4-6,10,15H2,1-3H3 |
| InChIKey | LPNXCCWVVAGKSQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|