hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate

C20H27O5PS — CID 170359256

IUPAChexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate
SMILESCCCCCCPOS(=O)(=O)c1ccc(OC)c(-c2ccccc2)c1OC
InChIInChI=1S/C20H27O5PS/c1-4-5-6-10-15-26-25-27(21,22)18-14-13-17(23-2)19(20(18)24-3)16-11-8-7-9-12-16/h7-9,11-14,26H,4-6,10,15H2,1-3H3
InChIKeyLPNXCCWVVAGKSQ-UHFFFAOYSA-N
MW410.47 g/mol
LogP5.25
Rot. Bonds11

About hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate

hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate (PubChem CID 170359256) has the molecular formula C20H27O5PS and a molecular weight of 410.47 g/mol. Its IUPAC name is hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate.

Molecular Properties

Compound Namehexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate
PubChem CID170359256
Molecular FormulaC20H27O5PS
Molecular Weight410.47 g/mol
Exact Mass410.13
IUPAC Namehexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate
SMILESCCCCCCPOS(=O)(=O)c1ccc(OC)c(-c2ccccc2)c1OC
InChIInChI=1S/C20H27O5PS/c1-4-5-6-10-15-26-25-27(21,22)18-14-13-17(23-2)19(20(18)24-3)16-11-8-7-9-12-16/h7-9,11-14,26H,4-6,10,15H2,1-3H3
InChIKeyLPNXCCWVVAGKSQ-UHFFFAOYSA-N
XLogP5.25
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds11
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500410.47
LogP ≤ 55.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
The IUPAC name of hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate (CID 170359256) is hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate.
What is the SMILES notation for hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
The canonical SMILES for hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate is CCCCCCPOS(=O)(=O)c1ccc(OC)c(-c2ccccc2)c1OC.
What is the InChIKey of hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
The InChIKey is LPNXCCWVVAGKSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27O5PS/c1-4-5-6-10-15-26-25-27(21,22)18-14-13-17(23-2)19(20(18)24-3)16-11-8-7-9-12-16/h7-9,11-14,26H,4-6,10,15H2,1-3H3.
What are the key properties of hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate has a molecular weight of 410.47 g/mol, XLogP of 5.25, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate is sourced from PubChem (CID 170359256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).