C20H19N5O — CID 163924449
12-(4-morpholin-4-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 163924449) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 12-(4-morpholin-4-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-(4-morpholin-4-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 163924449 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 12-(4-morpholin-4-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | Nc1cc2c(cn1)[nH]c1ncc(-c3ccc(N4CCOCC4)cc3)cc12 |
| InChI | InChI=1S/C20H19N5O/c21-19-10-16-17-9-14(11-23-20(17)24-18(16)12-22-19)13-1-3-15(4-2-13)25-5-7-26-8-6-25/h1-4,9-12H,5-8H2,(H2,21,22)(H,23,24) |
| InChIKey | RDGGVEYREIXPHE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |