C26H31N5 — CID 70942293
12-[3,5-diethyl-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942293) has the molecular formula C26H31N5 and a molecular weight of 413.57 g/mol. Its IUPAC name is 12-[3,5-diethyl-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-[3,5-diethyl-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942293 |
| Molecular Formula | C26H31N5 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 12-[3,5-diethyl-4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | CCc1cc(-c2cnc3[nH]c4cnc(N)cc4c3c2)cc(CC)c1CN1CCCCC1 |
| InChI | InChI=1S/C26H31N5/c1-3-17-10-19(11-18(4-2)23(17)16-31-8-6-5-7-9-31)20-12-22-21-13-25(27)28-15-24(21)30-26(22)29-14-20/h10-15H,3-9,16H2,1-2H3,(H2,27,28)(H,29,30) |
| InChIKey | LZZFCWDEIQWYNR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |