C24H26N6 — CID 143910491
(Z)-1-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]ethene-1,2-diamine (PubChem CID 143910491) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is (Z)-1-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]ethene-1,2-diamine.
| Compound Name | (Z)-1-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 143910491 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (Z)-1-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]ethene-1,2-diamine |
| SMILES | N/C=C(\N)c1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCCCC4)cc3)cc12 |
| InChI | InChI=1S/C24H26N6/c25-12-21(26)22-11-19-20-10-18(13-28-24(20)29-23(19)14-27-22)17-6-4-16(5-7-17)15-30-8-2-1-3-9-30/h4-7,10-14H,1-3,8-9,15,25-26H2,(H,28,29)/b21-12- |
| InChIKey | VNIVLZWCZBVKSC-MTJSOVHGSA-N |
| XLogP | 3.98 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |