C25H24N6 — CID 58266542
12-[4-(piperidin-1-ylmethyl)phenyl]-4-(3H-pyrazol-5-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58266542) has the molecular formula C25H24N6 and a molecular weight of 408.51 g/mol. Its IUPAC name is 12-[4-(piperidin-1-ylmethyl)phenyl]-4-(3H-pyrazol-5-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-[4-(piperidin-1-ylmethyl)phenyl]-4-(3H-pyrazol-5-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58266542 |
| Molecular Formula | C25H24N6 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 12-[4-(piperidin-1-ylmethyl)phenyl]-4-(3H-pyrazol-5-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | C1=C(c2cc3c(cn2)[nH]c2ncc(-c4ccc(CN5CCCCC5)cc4)cc23)N=NC1 |
| InChI | InChI=1S/C25H24N6/c1-2-10-31(11-3-1)16-17-4-6-18(7-5-17)19-12-21-20-13-23(22-8-9-28-30-22)26-15-24(20)29-25(21)27-14-19/h4-8,12-15H,1-3,9-11,16H2,(H,27,29) |
| InChIKey | ZTVLKPCGTKSSRJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |