C26H25N5S — CID 44545548
2-methyl-5-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]-1,3-thiazole (PubChem CID 44545548) has the molecular formula C26H25N5S and a molecular weight of 439.59 g/mol. Its IUPAC name is 2-methyl-5-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]-1,3-thiazole.
| Compound Name | 2-methyl-5-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 44545548 |
| Molecular Formula | C26H25N5S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-methyl-5-[12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl]-1,3-thiazole |
| SMILES | Cc1ncc(-c2cc3c(cn2)[nH]c2ncc(-c4ccc(CN5CCCCC5)cc4)cc23)s1 |
| InChI | InChI=1S/C26H25N5S/c1-17-27-15-25(32-17)23-12-21-22-11-20(13-29-26(22)30-24(21)14-28-23)19-7-5-18(6-8-19)16-31-9-3-2-4-10-31/h5-8,11-15H,2-4,9-10,16H2,1H3,(H,29,30) |
| InChIKey | YUFOXMXEOLWMFG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |