C25H28N7+ — CID 163916764
4-(3-methyl-1,2-dihydrotriazol-1-ium-4-yl)-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 163916764) has the molecular formula C25H28N7+ and a molecular weight of 426.55 g/mol. Its IUPAC name is 4-(3-methyl-1,2-dihydrotriazol-1-ium-4-yl)-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-(3-methyl-1,2-dihydrotriazol-1-ium-4-yl)-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 163916764 |
| Molecular Formula | C25H28N7+ |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-(3-methyl-1,2-dihydrotriazol-1-ium-4-yl)-12-[4-(piperidin-1-ylmethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CN1N[NH2+]C=C1c1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4CCCCC4)cc3)cc12 |
| InChI | InChI=1S/C25H27N7/c1-31-24(15-28-30-31)22-12-20-21-11-19(13-27-25(21)29-23(20)14-26-22)18-7-5-17(6-8-18)16-32-9-3-2-4-10-32/h5-8,11-15,28,30H,2-4,9-10,16H2,1H3,(H,27,29)/p+1 |
| InChIKey | QWXVNSGMZQDWJF-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|