C24H27N5O — CID 70942407
12-[3-methoxy-5-[(1-methylpiperidin-4-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942407) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 12-[3-methoxy-5-[(1-methylpiperidin-4-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-[3-methoxy-5-[(1-methylpiperidin-4-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942407 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 12-[3-methoxy-5-[(1-methylpiperidin-4-yl)methyl]phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | COc1cc(CC2CCN(C)CC2)cc(-c2cnc3[nH]c4cnc(N)cc4c3c2)c1 |
| InChI | InChI=1S/C24H27N5O/c1-29-5-3-15(4-6-29)7-16-8-17(10-19(9-16)30-2)18-11-21-20-12-23(25)26-14-22(20)28-24(21)27-13-18/h8-15H,3-7H2,1-2H3,(H2,25,26)(H,27,28) |
| InChIKey | DKSSUHSTMAGFQP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |