C17H15N5S — CID 70942409
12-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942409) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is 12-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942409 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 12-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | Nc1cc2c(cn1)[nH]c1ncc(-c3cc4c(s3)CCNC4)cc12 |
| InChI | InChI=1S/C17H15N5S/c18-16-5-11-12-3-9(7-21-17(12)22-13(11)8-20-16)15-4-10-6-19-2-1-14(10)23-15/h3-5,7-8,19H,1-2,6H2,(H2,18,20)(H,21,22) |
| InChIKey | HRWKCSZXUJGZJJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |