C22H15FN4O — CID 44546951
[2-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]methanol (PubChem CID 44546951) has the molecular formula C22H15FN4O and a molecular weight of 370.39 g/mol. Its IUPAC name is [2-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]methanol.
| Compound Name | [2-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]methanol |
|---|---|
| PubChem CID | 44546951 |
| Molecular Formula | C22H15FN4O |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]methanol |
| SMILES | OCc1ccccc1-c1c(F)cnc2[nH]c3cnc(-c4cccnc4)cc3c12 |
| InChI | InChI=1S/C22H15FN4O/c23-17-10-26-22-21(20(17)15-6-2-1-4-14(15)12-28)16-8-18(25-11-19(16)27-22)13-5-3-7-24-9-13/h1-11,28H,12H2,(H,26,27) |
| InChIKey | PDJXIXYBPZNKEJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |