C24H17F4N5O3 — CID 162332339
13-(2-ethoxy-3-pyridinyl)-12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;2,2,2-trifluoroacetic acid (PubChem CID 162332339) has the molecular formula C24H17F4N5O3 and a molecular weight of 499.42 g/mol. Its IUPAC name is 13-(2-ethoxy-3-pyridinyl)-12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;2,2,2-trifluoroacetic acid.
| Compound Name | 13-(2-ethoxy-3-pyridinyl)-12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162332339 |
| Molecular Formula | C24H17F4N5O3 |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 13-(2-ethoxy-3-pyridinyl)-12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ncccc1-c1c(F)cnc2[nH]c3cnc(-c4cccnc4)cc3c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H16FN5O.C2HF3O2/c1-2-29-22-14(6-4-8-25-22)19-16(23)11-27-21-20(19)15-9-17(26-12-18(15)28-21)13-5-3-7-24-10-13;3-2(4,5)1(6)7/h3-12H,2H2,1H3,(H,27,28);(H,6,7) |
| InChIKey | HPNMBVGJFQEDTH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |