C17H10N2O — CID 139524855
10-oxa-7,20-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene (PubChem CID 139524855) has the molecular formula C17H10N2O and a molecular weight of 258.28 g/mol. Its IUPAC name is 10-oxa-7,20-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene.
| Compound Name | 10-oxa-7,20-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 139524855 |
| Molecular Formula | C17H10N2O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 10-oxa-7,20-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene |
| SMILES | c1ccc2c(c1)[nH]c1cc3c(cc12)oc1cnccc13 |
| InChI | InChI=1S/C17H10N2O/c1-2-4-14-10(3-1)12-8-16-13(7-15(12)19-14)11-5-6-18-9-17(11)20-16/h1-9,19H |
| InChIKey | SPJZQDBMZFXOEZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |