C24H16N4 — CID 144569350
4,5-diphenyl-3,7,10,12-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),12,14-heptaene (PubChem CID 144569350) has the molecular formula C24H16N4 and a molecular weight of 360.42 g/mol. Its IUPAC name is 4,5-diphenyl-3,7,10,12-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),12,14-heptaene.
| Compound Name | 4,5-diphenyl-3,7,10,12-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 144569350 |
| Molecular Formula | C24H16N4 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4,5-diphenyl-3,7,10,12-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),12,14-heptaene |
| SMILES | c1ccc(-c2[nH]c3c(ncc4[nH]c5ncccc5c43)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H16N4/c1-3-8-15(9-4-1)19-21(16-10-5-2-6-11-16)28-23-20-17-12-7-13-25-24(17)27-18(20)14-26-22(19)23/h1-14,28H,(H,25,27) |
| InChIKey | KEDIYNKHUWZOCQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |