C19H13ClN2 — CID 45380817
6-chloro-2,3-diphenyl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 45380817) has the molecular formula C19H13ClN2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 6-chloro-2,3-diphenyl-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 6-chloro-2,3-diphenyl-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 45380817 |
| Molecular Formula | C19H13ClN2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 6-chloro-2,3-diphenyl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Clc1cc2[nH]c(-c3ccccc3)c(-c3ccccc3)c2cn1 |
| InChI | InChI=1S/C19H13ClN2/c20-17-11-16-15(12-21-17)18(13-7-3-1-4-8-13)19(22-16)14-9-5-2-6-10-14/h1-12,22H |
| InChIKey | RRUARYIVLRFVDM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|