C23H16N2 — CID 15355508
3,4-diphenyl-5H-pyrido[3,2-b]indole (PubChem CID 15355508) has the molecular formula C23H16N2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 3,4-diphenyl-5H-pyrido[3,2-b]indole.
| Compound Name | 3,4-diphenyl-5H-pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 15355508 |
| Molecular Formula | C23H16N2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3,4-diphenyl-5H-pyrido[3,2-b]indole |
| SMILES | c1ccc(-c2cnc3c([nH]c4ccccc43)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16N2/c1-3-9-16(10-4-1)19-15-24-22-18-13-7-8-14-20(18)25-23(22)21(19)17-11-5-2-6-12-17/h1-15,25H |
| InChIKey | ZXBYLKWUMZHTAJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |