C19H16N2 — CID 135060330
2-methyl-4-(2-methylphenyl)-9H-pyrido[2,3-b]indole (PubChem CID 135060330) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-methyl-4-(2-methylphenyl)-9H-pyrido[2,3-b]indole.
| Compound Name | 2-methyl-4-(2-methylphenyl)-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 135060330 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-methyl-4-(2-methylphenyl)-9H-pyrido[2,3-b]indole |
| SMILES | Cc1cc(-c2ccccc2C)c2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C19H16N2/c1-12-7-3-4-8-14(12)16-11-13(2)20-19-18(16)15-9-5-6-10-17(15)21-19/h3-11H,1-2H3,(H,20,21) |
| InChIKey | NZRSYNZHNYFSQM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |