C22H10F6N2S — CID 155760230
1-(1-benzothiophen-2-yl)-4,5-bis(trifluoromethyl)benzo[g]phthalazine (PubChem CID 155760230) has the molecular formula C22H10F6N2S and a molecular weight of 448.39 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-4,5-bis(trifluoromethyl)benzo[g]phthalazine.
| Compound Name | 1-(1-benzothiophen-2-yl)-4,5-bis(trifluoromethyl)benzo[g]phthalazine |
|---|---|
| PubChem CID | 155760230 |
| Molecular Formula | C22H10F6N2S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-4,5-bis(trifluoromethyl)benzo[g]phthalazine |
| SMILES | FC(F)(F)c1nnc(-c2cc3ccccc3s2)c2cc3ccccc3c(C(F)(F)F)c12 |
| InChI | InChI=1S/C22H10F6N2S/c23-21(24,25)18-13-7-3-1-5-11(13)9-14-17(18)20(22(26,27)28)30-29-19(14)16-10-12-6-2-4-8-15(12)31-16/h1-10H |
| InChIKey | CJLYNZIIUKLWAP-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|