C30H15F9N2OS — CID 157318003
1-(1-benzothiophen-2-yl)-4-[2-methyl-3,4,6-tris(trifluoromethyl)phenoxy]benzo[g]phthalazine (PubChem CID 157318003) has the molecular formula C30H15F9N2OS and a molecular weight of 622.51 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-4-[2-methyl-3,4,6-tris(trifluoromethyl)phenoxy]benzo[g]phthalazine.
| Compound Name | 1-(1-benzothiophen-2-yl)-4-[2-methyl-3,4,6-tris(trifluoromethyl)phenoxy]benzo[g]phthalazine |
|---|---|
| PubChem CID | 157318003 |
| Molecular Formula | C30H15F9N2OS |
| Molecular Weight | 622.51 g/mol |
| Exact Mass | 622.08 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-4-[2-methyl-3,4,6-tris(trifluoromethyl)phenoxy]benzo[g]phthalazine |
| SMILES | Cc1c(Oc2nnc(-c3cc4ccccc4s3)c3cc4ccccc4cc23)c(C(F)(F)F)cc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C30H15F9N2OS/c1-14-24(30(37,38)39)20(28(31,32)33)13-21(29(34,35)36)26(14)42-27-19-11-16-7-3-2-6-15(16)10-18(19)25(40-41-27)23-12-17-8-4-5-9-22(17)43-23/h2-13H,1H3 |
| InChIKey | MZKZYWINKJLUHA-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.51 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|