C19H9F3N4S — CID 156629434
1-(1-benzothiophen-2-yl)-4-(trifluoromethyl)pyridazino[4,5-b]quinoxaline (PubChem CID 156629434) has the molecular formula C19H9F3N4S and a molecular weight of 382.37 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-4-(trifluoromethyl)pyridazino[4,5-b]quinoxaline.
| Compound Name | 1-(1-benzothiophen-2-yl)-4-(trifluoromethyl)pyridazino[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 156629434 |
| Molecular Formula | C19H9F3N4S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-4-(trifluoromethyl)pyridazino[4,5-b]quinoxaline |
| SMILES | FC(F)(F)c1nnc(-c2cc3ccccc3s2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C19H9F3N4S/c20-19(21,22)18-17-16(23-11-6-2-3-7-12(11)24-17)15(25-26-18)14-9-10-5-1-4-8-13(10)27-14/h1-9H |
| InChIKey | LYZMEKSNVSKQGY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|