C19H12N4S — CID 156629457
1-(1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxaline (PubChem CID 156629457) has the molecular formula C19H12N4S and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxaline.
| Compound Name | 1-(1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 156629457 |
| Molecular Formula | C19H12N4S |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-4-(trideuteriomethyl)pyridazino[4,5-b]quinoxaline |
| SMILES | [2H]C([2H])([2H])c1nnc(-c2cc3ccccc3s2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C19H12N4S/c1-11-17-19(21-14-8-4-3-7-13(14)20-17)18(23-22-11)16-10-12-6-2-5-9-15(12)24-16/h2-10H,1H3/i1D3 |
| InChIKey | PEOQGSDVXIPRSQ-FIBGUPNXSA-N |
| XLogP | 4.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|