C15H9N3S — CID 170567146
5-(1-benzothiophen-2-yl)pyrido[3,4-b]pyrazine (PubChem CID 170567146) has the molecular formula C15H9N3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)pyrido[3,4-b]pyrazine.
| Compound Name | 5-(1-benzothiophen-2-yl)pyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 170567146 |
| Molecular Formula | C15H9N3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)pyrido[3,4-b]pyrazine |
| SMILES | c1ccc2sc(-c3nccc4nccnc34)cc2c1 |
| InChI | InChI=1S/C15H9N3S/c1-2-4-12-10(3-1)9-13(19-12)15-14-11(5-6-17-15)16-7-8-18-14/h1-9H |
| InChIKey | JDFNAIZTPZQXPF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |