C32H26Cl4F2N2O2 — CID 87785930
1-[[5-chloro-7-(2,5-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-[[5-chloro-7-(2,5-difluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-1,2-dimethylhydrazine (PubChem CID 87785930) has the molecular formula C32H26Cl4F2N2O2 and a molecular weight of 650.38 g/mol. Its IUPAC name is 1-[[5-chloro-7-(2,5-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-[[5-chloro-7-(2,5-difluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-1,2-dimethylhydrazine.
| Compound Name | 1-[[5-chloro-7-(2,5-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-[[5-chloro-7-(2,5-difluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 87785930 |
| Molecular Formula | C32H26Cl4F2N2O2 |
| Molecular Weight | 650.38 g/mol |
| Exact Mass | 648.07 |
| IUPAC Name | 1-[[5-chloro-7-(2,5-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-[[5-chloro-7-(2,5-difluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-1,2-dimethylhydrazine |
| SMILES | CN(CC1Cc2cc(Cl)cc(-c3cc(F)ccc3F)c2O1)N(C)CC1Cc2cc(Cl)cc(-c3cc(Cl)ccc3Cl)c2O1 |
| InChI | InChI=1S/C32H26Cl4F2N2O2/c1-39(15-23-9-17-7-20(34)12-27(31(17)41-23)25-11-19(33)3-5-29(25)36)40(2)16-24-10-18-8-21(35)13-28(32(18)42-24)26-14-22(37)4-6-30(26)38/h3-8,11-14,23-24H,9-10,15-16H2,1-2H3 |
| InChIKey | LCKSWQMRJLOJAZ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.38 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|