C24H30O6S2 — CID 10972848
2-[(1S,6S)-6-[2-(4-methylphenyl)sulfonyloxyethyl]cyclohex-3-en-1-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 10972848) has the molecular formula C24H30O6S2 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[(1S,6S)-6-[2-(4-methylphenyl)sulfonyloxyethyl]cyclohex-3-en-1-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1S,6S)-6-[2-(4-methylphenyl)sulfonyloxyethyl]cyclohex-3-en-1-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10972848 |
| Molecular Formula | C24H30O6S2 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[(1S,6S)-6-[2-(4-methylphenyl)sulfonyloxyethyl]cyclohex-3-en-1-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2CC=CC[C@H]2CCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H30O6S2/c1-19-7-11-23(12-8-19)31(25,26)29-17-15-21-5-3-4-6-22(21)16-18-30-32(27,28)24-13-9-20(2)10-14-24/h3-4,7-14,21-22H,5-6,15-18H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | DBMLPPXPPUVVQZ-VXKWHMMOSA-N |
| XLogP | 4.78 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|