C16H22FNO5S — CID 175985803
butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate (PubChem CID 175985803) has the molecular formula C16H22FNO5S and a molecular weight of 359.42 g/mol. Its IUPAC name is butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate.
| Compound Name | butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 175985803 |
| Molecular Formula | C16H22FNO5S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC(F)(COS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C16H22FNO5S/c1-3-4-9-22-15(19)18-10-16(17,11-18)12-23-24(20,21)14-7-5-13(2)6-8-14/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | GDGRMOBGDNVQPG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|