C22H32N2O6S — CID 165146530
butyl (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 165146530) has the molecular formula C22H32N2O6S and a molecular weight of 452.57 g/mol. Its IUPAC name is butyl (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | butyl (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 165146530 |
| Molecular Formula | C22H32N2O6S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | butyl (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)C[C@H](CCOS(=O)(=O)c1ccc(C)cc1)NC2=O |
| InChI | InChI=1S/C22H32N2O6S/c1-3-4-14-29-21(26)24-12-10-22(11-13-24)16-18(23-20(22)25)9-15-30-31(27,28)19-7-5-17(2)6-8-19/h5-8,18H,3-4,9-16H2,1-2H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | JWSLKGPWEXCIHL-SFHVURJKSA-N |
| XLogP | 3.00 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|