C18H24N2O6S — CID 146242734
(3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylic acid (PubChem CID 146242734) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 146242734 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (3R)-3-[2-(4-methylphenyl)sulfonyloxyethyl]-1-oxo-2,8-diazaspiro[4.5]decane-8-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@H]2CC3(CCN(C(=O)O)CC3)C(=O)N2)cc1 |
| InChI | InChI=1S/C18H24N2O6S/c1-13-2-4-15(5-3-13)27(24,25)26-11-6-14-12-18(16(21)19-14)7-9-20(10-8-18)17(22)23/h2-5,14H,6-12H2,1H3,(H,19,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | YFZBNCYIHJPTGP-AWEZNQCLSA-N |
| XLogP | 1.74 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|