C20H30N2O4S — CID 167673395
3-[(3S)-8-ethyl-1-oxo-2,8-diazaspiro[4.5]decan-3-yl]propyl 4-methylbenzenesulfonate (PubChem CID 167673395) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is 3-[(3S)-8-ethyl-1-oxo-2,8-diazaspiro[4.5]decan-3-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[(3S)-8-ethyl-1-oxo-2,8-diazaspiro[4.5]decan-3-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167673395 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-[(3S)-8-ethyl-1-oxo-2,8-diazaspiro[4.5]decan-3-yl]propyl 4-methylbenzenesulfonate |
| SMILES | CCN1CCC2(CC1)C[C@H](CCCOS(=O)(=O)c1ccc(C)cc1)NC2=O |
| InChI | InChI=1S/C20H30N2O4S/c1-3-22-12-10-20(11-13-22)15-17(21-19(20)23)5-4-14-26-27(24,25)18-8-6-16(2)7-9-18/h6-9,17H,3-5,10-15H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | ULNYDCZZKCRZFO-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|